C13H18O2S — CID 117349655
3-[2-(thiolan-3-yloxy)phenyl]propan-1-ol (PubChem CID 117349655) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 3-[2-(thiolan-3-yloxy)phenyl]propan-1-ol.
| Compound Name | 3-[2-(thiolan-3-yloxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117349655 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-[2-(thiolan-3-yloxy)phenyl]propan-1-ol |
| SMILES | OCCCc1ccccc1OC1CCSC1 |
| InChI | InChI=1S/C13H18O2S/c14-8-3-5-11-4-1-2-6-13(11)15-12-7-9-16-10-12/h1-2,4,6,12,14H,3,5,7-10H2 |
| InChIKey | GTHWBHBGXAJWEO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |