C12H16O4S — CID 117394319
3-[2-(1,1-dioxothietan-3-yl)oxyphenyl]propan-1-ol (PubChem CID 117394319) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-[2-(1,1-dioxothietan-3-yl)oxyphenyl]propan-1-ol.
| Compound Name | 3-[2-(1,1-dioxothietan-3-yl)oxyphenyl]propan-1-ol |
|---|---|
| PubChem CID | 117394319 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[2-(1,1-dioxothietan-3-yl)oxyphenyl]propan-1-ol |
| SMILES | O=S1(=O)CC(Oc2ccccc2CCCO)C1 |
| InChI | InChI=1S/C12H16O4S/c13-7-3-5-10-4-1-2-6-12(10)16-11-8-17(14,15)9-11/h1-2,4,6,11,13H,3,5,7-9H2 |
| InChIKey | BFINPWGPQPWROI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |