C16H25NO — CID 170866480
3-(2-cyclopentyloxyphenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170866480) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-(2-cyclopentyloxyphenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-cyclopentyloxyphenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866480 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-(2-cyclopentyloxyphenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccccc1OC1CCCC1 |
| InChI | InChI=1S/C16H25NO/c1-17(2)13-7-9-14-8-3-6-12-16(14)18-15-10-4-5-11-15/h3,6,8,12,15H,4-5,7,9-11,13H2,1-2H3 |
| InChIKey | JGYDQDOAIMZMOT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |