C13H19NO3S — CID 117426921
O-[[2-methoxy-3-(thian-3-yloxy)phenyl]methyl]hydroxylamine (PubChem CID 117426921) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is O-[[2-methoxy-3-(thian-3-yloxy)phenyl]methyl]hydroxylamine.
| Compound Name | O-[[2-methoxy-3-(thian-3-yloxy)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117426921 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | O-[[2-methoxy-3-(thian-3-yloxy)phenyl]methyl]hydroxylamine |
| SMILES | COc1c(CON)cccc1OC1CCCSC1 |
| InChI | InChI=1S/C13H19NO3S/c1-15-13-10(8-16-14)4-2-6-12(13)17-11-5-3-7-18-9-11/h2,4,6,11H,3,5,7-9,14H2,1H3 |
| InChIKey | ZMZTXZVROKSDHQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|