C16H22O4S — CID 117495420
4-[2-methoxy-3-(thian-3-yloxy)phenyl]butanoic acid (PubChem CID 117495420) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-[2-methoxy-3-(thian-3-yloxy)phenyl]butanoic acid.
| Compound Name | 4-[2-methoxy-3-(thian-3-yloxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117495420 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-[2-methoxy-3-(thian-3-yloxy)phenyl]butanoic acid |
| SMILES | COc1c(CCCC(=O)O)cccc1OC1CCCSC1 |
| InChI | InChI=1S/C16H22O4S/c1-19-16-12(6-3-9-15(17)18)5-2-8-14(16)20-13-7-4-10-21-11-13/h2,5,8,13H,3-4,6-7,9-11H2,1H3,(H,17,18) |
| InChIKey | IPLDIASFZDIBBH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |