C15H15NO5 — CID 117467181
3-[4-(oxan-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117467181) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 3-[4-(oxan-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[4-(oxan-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117467181 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[4-(oxan-3-yloxy)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(OC3CCCOC3)cc2)no1 |
| InChI | InChI=1S/C15H15NO5/c17-15(18)14-8-13(16-21-14)10-3-5-11(6-4-10)20-12-2-1-7-19-9-12/h3-6,8,12H,1-2,7,9H2,(H,17,18) |
| InChIKey | ANWVRDVJAYYCCG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |