3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid

C14H13NO4 — CID 117401338

IUPAC3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(CC3COC3)cc2)no1
InChIInChI=1S/C14H13NO4/c16-14(17)13-6-12(15-19-13)11-3-1-9(2-4-11)5-10-7-18-8-10/h1-4,6,10H,5,7-8H2,(H,16,17)
InChIKeyXTXXEXSEQJRNPU-UHFFFAOYSA-N
MW259.26 g/mol
LogP2.23
Rot. Bonds4

About 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid

3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117401338) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid
PubChem CID117401338
Molecular FormulaC14H13NO4
Molecular Weight259.26 g/mol
Exact Mass259.08
IUPAC Name3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(CC3COC3)cc2)no1
InChIInChI=1S/C14H13NO4/c16-14(17)13-6-12(15-19-13)11-3-1-9(2-4-11)5-10-7-18-8-10/h1-4,6,10H,5,7-8H2,(H,16,17)
InChIKeyXTXXEXSEQJRNPU-UHFFFAOYSA-N
XLogP2.23
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.26
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid (CID 117401338) is 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(-c2ccc(CC3COC3)cc2)no1.
What is the InChIKey of 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is XTXXEXSEQJRNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c16-14(17)13-6-12(15-19-13)11-3-1-9(2-4-11)5-10-7-18-8-10/h1-4,6,10H,5,7-8H2,(H,16,17).
What are the key properties of 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid?
3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 259.26 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117401338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).