C14H13NO4 — CID 117401338
3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 117401338) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117401338 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-[4-(oxetan-3-ylmethyl)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(CC3COC3)cc2)no1 |
| InChI | InChI=1S/C14H13NO4/c16-14(17)13-6-12(15-19-13)11-3-1-9(2-4-11)5-10-7-18-8-10/h1-4,6,10H,5,7-8H2,(H,16,17) |
| InChIKey | XTXXEXSEQJRNPU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |