C14H14N2O3 — CID 117399119
3-(4-cyclobutyloxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117399119) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-(4-cyclobutyloxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(4-cyclobutyloxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117399119 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(4-cyclobutyloxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(OC3CCC3)cc2)n[nH]1 |
| InChI | InChI=1S/C14H14N2O3/c17-14(18)13-8-12(15-16-13)9-4-6-11(7-5-9)19-10-2-1-3-10/h4-8,10H,1-3H2,(H,15,16)(H,17,18) |
| InChIKey | FAFOQLUCMNZBBO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |