C23H25N3O2 — CID 154850398
[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(3-phenoxypiperidin-1-yl)methanone (PubChem CID 154850398) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(3-phenoxypiperidin-1-yl)methanone.
| Compound Name | [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(3-phenoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 154850398 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(3-phenoxypiperidin-1-yl)methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCCC(Oc4ccccc4)C3)[nH]n2)cc1C |
| InChI | InChI=1S/C23H25N3O2/c1-16-10-11-18(13-17(16)2)21-14-22(25-24-21)23(27)26-12-6-9-20(15-26)28-19-7-4-3-5-8-19/h3-5,7-8,10-11,13-14,20H,6,9,12,15H2,1-2H3,(H,24,25) |
| InChIKey | FSGKHQVTECGMGF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |