C14H17N3O — CID 117360352
5-(3-piperidin-4-ylphenyl)-1,2-oxazol-3-amine (PubChem CID 117360352) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-(3-piperidin-4-ylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(3-piperidin-4-ylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117360352 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-(3-piperidin-4-ylphenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2cccc(C3CCNCC3)c2)on1 |
| InChI | InChI=1S/C14H17N3O/c15-14-9-13(18-17-14)12-3-1-2-11(8-12)10-4-6-16-7-5-10/h1-3,8-10,16H,4-7H2,(H2,15,17) |
| InChIKey | KTEOFSJOGWJCBJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |