C14H16N2O3 — CID 117404768
5-[4-(oxan-4-yloxy)phenyl]-1,2-oxazol-3-amine (PubChem CID 117404768) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-[4-(oxan-4-yloxy)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[4-(oxan-4-yloxy)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117404768 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-[4-(oxan-4-yloxy)phenyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2ccc(OC3CCOCC3)cc2)on1 |
| InChI | InChI=1S/C14H16N2O3/c15-14-9-13(19-16-14)10-1-3-11(4-2-10)18-12-5-7-17-8-6-12/h1-4,9,12H,5-8H2,(H2,15,16) |
| InChIKey | FYSHBOMJEGAVFX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |