C10H9N3O3 — CID 175331108
[4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate (PubChem CID 175331108) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate.
| Compound Name | [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate |
|---|---|
| PubChem CID | 175331108 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(-c2cc(N)no2)cc1 |
| InChI | InChI=1S/C10H9N3O3/c11-9-5-8(16-13-9)6-1-3-7(4-2-6)15-10(12)14/h1-5H,(H2,11,13)(H2,12,14) |
| InChIKey | RVUXXZWLIXQBKL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |