About [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate
[4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate (PubChem CID 175331108) has the molecular formula C10H9N3O3
and a molecular weight of 219.20 g/mol. Its IUPAC name is [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate.
Molecular Properties
| Compound Name | [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate |
| PubChem CID | 175331108 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(-c2cc(N)no2)cc1 |
| InChI | InChI=1S/C10H9N3O3/c11-9-5-8(16-13-9)6-1-3-7(4-2-6)15-10(12)14/h1-5H,(H2,11,13)(H2,12,14) |
| InChIKey | RVUXXZWLIXQBKL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate?
The IUPAC name of [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate (CID 175331108) is [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate.
What is the SMILES notation for [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate?
The canonical SMILES for [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate is NC(=O)Oc1ccc(-c2cc(N)no2)cc1.
What is the InChIKey of [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate?
The InChIKey is RVUXXZWLIXQBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c11-9-5-8(16-13-9)6-1-3-7(4-2-6)15-10(12)14/h1-5H,(H2,11,13)(H2,12,14).
What are the key properties of [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate?
[4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate has a molecular weight of 219.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-amino-1,2-oxazol-5-yl)phenyl] carbamate is sourced from PubChem (CID 175331108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).