C12H15ClN2O3 — CID 117429830
2-amino-2-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]acetic acid (PubChem CID 117429830) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-amino-2-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]acetic acid.
| Compound Name | 2-amino-2-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 117429830 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-amino-2-[3-chloro-4-(1-methylazetidin-3-yl)oxyphenyl]acetic acid |
| SMILES | CN1CC(Oc2ccc(C(N)C(=O)O)cc2Cl)C1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-15-5-8(6-15)18-10-3-2-7(4-9(10)13)11(14)12(16)17/h2-4,8,11H,5-6,14H2,1H3,(H,16,17) |
| InChIKey | ISENHVGPBXMLRI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |