C11H12ClNO3S — CID 117437097
2-amino-2-[3-chloro-4-(thietan-3-yloxy)phenyl]acetic acid (PubChem CID 117437097) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-amino-2-[3-chloro-4-(thietan-3-yloxy)phenyl]acetic acid.
| Compound Name | 2-amino-2-[3-chloro-4-(thietan-3-yloxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 117437097 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-amino-2-[3-chloro-4-(thietan-3-yloxy)phenyl]acetic acid |
| SMILES | NC(C(=O)O)c1ccc(OC2CSC2)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-8-3-6(10(13)11(14)15)1-2-9(8)16-7-4-17-5-7/h1-3,7,10H,4-5,13H2,(H,14,15) |
| InChIKey | LBVOYZBVVDWSCB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |