C14H19NO4 — CID 66513349
(2S)-2-amino-2-(4-cyclopentyloxy-3-methoxyphenyl)acetic acid (PubChem CID 66513349) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S)-2-amino-2-(4-cyclopentyloxy-3-methoxyphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(4-cyclopentyloxy-3-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 66513349 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S)-2-amino-2-(4-cyclopentyloxy-3-methoxyphenyl)acetic acid |
| SMILES | COc1cc([C@H](N)C(=O)O)ccc1OC1CCCC1 |
| InChI | InChI=1S/C14H19NO4/c1-18-12-8-9(13(15)14(16)17)6-7-11(12)19-10-4-2-3-5-10/h6-8,10,13H,2-5,15H2,1H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | UGEUGKUAZSYNPA-ZDUSSCGKSA-N |
| XLogP | 2.10 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |