C12H13ClO3S — CID 117434667
3-[3-chloro-4-(thietan-3-yloxy)phenyl]propanoic acid (PubChem CID 117434667) has the molecular formula C12H13ClO3S and a molecular weight of 272.75 g/mol. Its IUPAC name is 3-[3-chloro-4-(thietan-3-yloxy)phenyl]propanoic acid.
| Compound Name | 3-[3-chloro-4-(thietan-3-yloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117434667 |
| Molecular Formula | C12H13ClO3S |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-[3-chloro-4-(thietan-3-yloxy)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OC2CSC2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClO3S/c13-10-5-8(2-4-12(14)15)1-3-11(10)16-9-6-17-7-9/h1,3,5,9H,2,4,6-7H2,(H,14,15) |
| InChIKey | FQWGTHKRZLSVMP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |