C19H17NO4 — CID 82039986
2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzaldehyde (PubChem CID 82039986) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzaldehyde.
| Compound Name | 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 82039986 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2,3-dimethoxy-5-(8-methoxyquinolin-5-yl)benzaldehyde |
| SMILES | COc1cc(-c2ccc(OC)c3ncccc23)cc(C=O)c1OC |
| InChI | InChI=1S/C19H17NO4/c1-22-16-7-6-14(15-5-4-8-20-18(15)16)12-9-13(11-21)19(24-3)17(10-12)23-2/h4-11H,1-3H3 |
| InChIKey | IVMDGVAAKUVQMO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|