C17H15NO3 — CID 82039787
5-(1H-indol-3-yl)-2,3-dimethoxybenzaldehyde (PubChem CID 82039787) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-2,3-dimethoxybenzaldehyde.
| Compound Name | 5-(1H-indol-3-yl)-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 82039787 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-(1H-indol-3-yl)-2,3-dimethoxybenzaldehyde |
| SMILES | COc1cc(-c2c[nH]c3ccccc23)cc(C=O)c1OC |
| InChI | InChI=1S/C17H15NO3/c1-20-16-8-11(7-12(10-19)17(16)21-2)14-9-18-15-6-4-3-5-13(14)15/h3-10,18H,1-2H3 |
| InChIKey | KGFBPMWLHFHWPB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|