C17H17NO5Se — CID 74763389
3-(3,4,5-trimethoxyphenyl)selenonyl-1H-indole (PubChem CID 74763389) has the molecular formula C17H17NO5Se and a molecular weight of 394.29 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)selenonyl-1H-indole.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)selenonyl-1H-indole |
|---|---|
| PubChem CID | 74763389 |
| Molecular Formula | C17H17NO5Se |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)selenonyl-1H-indole |
| SMILES | COc1cc([Se](=O)(=O)c2c[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C17H17NO5Se/c1-21-14-8-11(9-15(22-2)17(14)23-3)24(19,20)16-10-18-13-7-5-4-6-12(13)16/h4-10,18H,1-3H3 |
| InChIKey | MRTUCBKGVHKTQE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|