C22H18N2O6 — CID 22410568
(Z)-2-(5,6-dimethoxy-1H-indol-3-yl)-3-(1H-indol-3-yl)but-2-enedioic acid (PubChem CID 22410568) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is (Z)-2-(5,6-dimethoxy-1H-indol-3-yl)-3-(1H-indol-3-yl)but-2-enedioic acid.
| Compound Name | (Z)-2-(5,6-dimethoxy-1H-indol-3-yl)-3-(1H-indol-3-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 22410568 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (Z)-2-(5,6-dimethoxy-1H-indol-3-yl)-3-(1H-indol-3-yl)but-2-enedioic acid |
| SMILES | COc1cc2[nH]cc(/C(C(=O)O)=C(/C(=O)O)c3c[nH]c4ccccc34)c2cc1OC |
| InChI | InChI=1S/C22H18N2O6/c1-29-17-7-12-14(10-24-16(12)8-18(17)30-2)20(22(27)28)19(21(25)26)13-9-23-15-6-4-3-5-11(13)15/h3-10,23-24H,1-2H3,(H,25,26)(H,27,28)/b20-19- |
| InChIKey | MXJYKRRQDVVNEZ-VXPUYCOJSA-N |
| XLogP | 3.75 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|