C18H16ClN3O4 — CID 30455952
N'-(3-chloro-4,5-dimethoxybenzoyl)-1H-indole-3-carbohydrazide (PubChem CID 30455952) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is N'-(3-chloro-4,5-dimethoxybenzoyl)-1H-indole-3-carbohydrazide.
| Compound Name | N'-(3-chloro-4,5-dimethoxybenzoyl)-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 30455952 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N'-(3-chloro-4,5-dimethoxybenzoyl)-1H-indole-3-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2c[nH]c3ccccc23)cc(Cl)c1OC |
| InChI | InChI=1S/C18H16ClN3O4/c1-25-15-8-10(7-13(19)16(15)26-2)17(23)21-22-18(24)12-9-20-14-6-4-3-5-11(12)14/h3-9,20H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | FDISROITHKLNEL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|