C17H14F2N2O3 — CID 113207048
N-(2,6-difluorophenyl)-5,6-dimethoxy-1H-indole-3-carboxamide (PubChem CID 113207048) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5,6-dimethoxy-1H-indole-3-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-5,6-dimethoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113207048 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-(2,6-difluorophenyl)-5,6-dimethoxy-1H-indole-3-carboxamide |
| SMILES | COc1cc2[nH]cc(C(=O)Nc3c(F)cccc3F)c2cc1OC |
| InChI | InChI=1S/C17H14F2N2O3/c1-23-14-6-9-10(8-20-13(9)7-15(14)24-2)17(22)21-16-11(18)4-3-5-12(16)19/h3-8,20H,1-2H3,(H,21,22) |
| InChIKey | PIEJMADFPFOHFG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |