C20H22N2O4 — CID 113206991
5,6-dimethoxy-N-(2-propan-2-yloxyphenyl)-1H-indole-3-carboxamide (PubChem CID 113206991) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5,6-dimethoxy-N-(2-propan-2-yloxyphenyl)-1H-indole-3-carboxamide.
| Compound Name | 5,6-dimethoxy-N-(2-propan-2-yloxyphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206991 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 5,6-dimethoxy-N-(2-propan-2-yloxyphenyl)-1H-indole-3-carboxamide |
| SMILES | COc1cc2[nH]cc(C(=O)Nc3ccccc3OC(C)C)c2cc1OC |
| InChI | InChI=1S/C20H22N2O4/c1-12(2)26-17-8-6-5-7-15(17)22-20(23)14-11-21-16-10-19(25-4)18(24-3)9-13(14)16/h5-12,21H,1-4H3,(H,22,23) |
| InChIKey | ZUEUKCLLSZOPCJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |