C19H19ClN2O3 — CID 113206980
N-(2-chloro-4,6-dimethylphenyl)-5,6-dimethoxy-1H-indole-3-carboxamide (PubChem CID 113206980) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-5,6-dimethoxy-1H-indole-3-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-5,6-dimethoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206980 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-5,6-dimethoxy-1H-indole-3-carboxamide |
| SMILES | COc1cc2[nH]cc(C(=O)Nc3c(C)cc(C)cc3Cl)c2cc1OC |
| InChI | InChI=1S/C19H19ClN2O3/c1-10-5-11(2)18(14(20)6-10)22-19(23)13-9-21-15-8-17(25-4)16(24-3)7-12(13)15/h5-9,21H,1-4H3,(H,22,23) |
| InChIKey | LITUDXCROWAWOG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |