C12H12ClNO3 — CID 907553
2-chloro-1-(5,6-dimethoxy-1H-indol-3-yl)ethanone (PubChem CID 907553) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is 2-chloro-1-(5,6-dimethoxy-1H-indol-3-yl)ethanone.
| Compound Name | 2-chloro-1-(5,6-dimethoxy-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 907553 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-chloro-1-(5,6-dimethoxy-1H-indol-3-yl)ethanone |
| SMILES | COc1cc2[nH]cc(C(=O)CCl)c2cc1OC |
| InChI | InChI=1S/C12H12ClNO3/c1-16-11-3-7-8(10(15)5-13)6-14-9(7)4-12(11)17-2/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | DNAWOYJKUAXVLW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|