C17H24N2O3 — CID 113206941
5,6-dimethoxy-N,N-dipropyl-1H-indole-3-carboxamide (PubChem CID 113206941) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5,6-dimethoxy-N,N-dipropyl-1H-indole-3-carboxamide.
| Compound Name | 5,6-dimethoxy-N,N-dipropyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206941 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 5,6-dimethoxy-N,N-dipropyl-1H-indole-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1c[nH]c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C17H24N2O3/c1-5-7-19(8-6-2)17(20)13-11-18-14-10-16(22-4)15(21-3)9-12(13)14/h9-11,18H,5-8H2,1-4H3 |
| InChIKey | CXNXUOMXZGSXGT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |