C15H23NO2 — CID 110761077
2-methoxy-5-methyl-N,N-dipropylbenzamide (PubChem CID 110761077) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-methoxy-5-methyl-N,N-dipropylbenzamide.
| Compound Name | 2-methoxy-5-methyl-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 110761077 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-methoxy-5-methyl-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C15H23NO2/c1-5-9-16(10-6-2)15(17)13-11-12(3)7-8-14(13)18-4/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | XRTIKJORLLYBHF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |