C13H15ClF3NO2 — CID 107492183
N-(2-chloroethyl)-2-methoxy-5-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107492183) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-methoxy-5-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2-chloroethyl)-2-methoxy-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107492183 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(2-chloroethyl)-2-methoxy-5-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1ccc(C)cc1C(=O)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C13H15ClF3NO2/c1-9-3-4-11(20-2)10(7-9)12(19)18(6-5-14)8-13(15,16)17/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | NSVZCFVPSAPHCB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|