C12H12ClF4NO2 — CID 107492036
N-(2-chloroethyl)-3-fluoro-4-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107492036) has the molecular formula C12H12ClF4NO2 and a molecular weight of 313.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-fluoro-4-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2-chloroethyl)-3-fluoro-4-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107492036 |
| Molecular Formula | C12H12ClF4NO2 |
| Molecular Weight | 313.68 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(2-chloroethyl)-3-fluoro-4-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCCl)CC(F)(F)F)cc1F |
| InChI | InChI=1S/C12H12ClF4NO2/c1-20-10-3-2-8(6-9(10)14)11(19)18(5-4-13)7-12(15,16)17/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | FDLKTCQOXGSASO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|