C11H9BrCl2F3NO — CID 107492122
4-bromo-3-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107492122) has the molecular formula C11H9BrCl2F3NO and a molecular weight of 379.00 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107492122 |
| Molecular Formula | C11H9BrCl2F3NO |
| Molecular Weight | 379.00 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 4-bromo-3-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1ccc(Br)c(Cl)c1)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C11H9BrCl2F3NO/c12-8-2-1-7(5-9(8)14)10(19)18(4-3-13)6-11(15,16)17/h1-2,5H,3-4,6H2 |
| InChIKey | QIFAEBINSYKRMA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|