C17H15ClN2O — CID 113205562
N-(2-chloro-4,6-dimethylphenyl)-1H-indole-3-carboxamide (PubChem CID 113205562) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-1H-indole-3-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113205562 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-1H-indole-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2c[nH]c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O/c1-10-7-11(2)16(14(18)8-10)20-17(21)13-9-19-15-6-4-3-5-12(13)15/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | MQGYCJIYFSXPFA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |