C18H15N3OS — CID 43989177
N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1H-indole-3-carboxamide (PubChem CID 43989177) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1H-indole-3-carboxamide.
| Compound Name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 43989177 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1H-indole-3-carboxamide |
| SMILES | Cc1cc(C)c2sc(NC(=O)c3c[nH]c4ccccc34)nc2c1 |
| InChI | InChI=1S/C18H15N3OS/c1-10-7-11(2)16-15(8-10)20-18(23-16)21-17(22)13-9-19-14-6-4-3-5-12(13)14/h3-9,19H,1-2H3,(H,20,21,22) |
| InChIKey | BHBSHXKTMXVRLN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |