C13H11Cl2NO4S — CID 175086946
benzoic acid;2,4-dichlorobenzenesulfonamide (PubChem CID 175086946) has the molecular formula C13H11Cl2NO4S and a molecular weight of 348.21 g/mol. Its IUPAC name is benzoic acid;2,4-dichlorobenzenesulfonamide.
| Compound Name | benzoic acid;2,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 175086946 |
| Molecular Formula | C13H11Cl2NO4S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | benzoic acid;2,4-dichlorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)cc1Cl.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H5Cl2NO2S/c8-7(9)6-4-2-1-3-5-6;7-4-1-2-6(5(8)3-4)12(9,10)11/h1-5H,(H,8,9);1-3H,(H2,9,10,11) |
| InChIKey | LDBSNDXMPDAERP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |