C14H12ClN3O6S2 — CID 101117427
N-(5-chloro-2,4-disulfamoylphenyl)-2-oxo-2-phenylacetamide (PubChem CID 101117427) has the molecular formula C14H12ClN3O6S2 and a molecular weight of 417.85 g/mol. Its IUPAC name is N-(5-chloro-2,4-disulfamoylphenyl)-2-oxo-2-phenylacetamide.
| Compound Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-oxo-2-phenylacetamide |
|---|---|
| PubChem CID | 101117427 |
| Molecular Formula | C14H12ClN3O6S2 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-oxo-2-phenylacetamide |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(NC(=O)C(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C14H12ClN3O6S2/c15-9-6-10(12(26(17,23)24)7-11(9)25(16,21)22)18-14(20)13(19)8-4-2-1-3-5-8/h1-7H,(H,18,20)(H2,16,21,22)(H2,17,23,24) |
| InChIKey | NYVCYOVWXLLKGS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 166.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|