C9H9ClN4O5S2 — CID 168520102
N-(5-chloro-2,4-disulfamoylphenyl)-2-cyanoacetamide (PubChem CID 168520102) has the molecular formula C9H9ClN4O5S2 and a molecular weight of 352.78 g/mol. Its IUPAC name is N-(5-chloro-2,4-disulfamoylphenyl)-2-cyanoacetamide.
| Compound Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 168520102 |
| Molecular Formula | C9H9ClN4O5S2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1cc(Cl)c(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H9ClN4O5S2/c10-5-3-6(14-9(15)1-2-11)8(21(13,18)19)4-7(5)20(12,16)17/h3-4H,1H2,(H,14,15)(H2,12,16,17)(H2,13,18,19) |
| InChIKey | RVAWYBUKGXBRLH-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 173.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |