C15H16ClN3O5S3 — CID 134098190
N-(5-chloro-2,4-disulfamoylphenyl)-3-phenylsulfanylpropanamide (PubChem CID 134098190) has the molecular formula C15H16ClN3O5S3 and a molecular weight of 449.96 g/mol. Its IUPAC name is N-(5-chloro-2,4-disulfamoylphenyl)-3-phenylsulfanylpropanamide.
| Compound Name | N-(5-chloro-2,4-disulfamoylphenyl)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 134098190 |
| Molecular Formula | C15H16ClN3O5S3 |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | N-(5-chloro-2,4-disulfamoylphenyl)-3-phenylsulfanylpropanamide |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(NC(=O)CCSc2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H16ClN3O5S3/c16-11-8-12(14(27(18,23)24)9-13(11)26(17,21)22)19-15(20)6-7-25-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,19,20)(H2,17,21,22)(H2,18,23,24) |
| InChIKey | UOCQJBJHOUGWOR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |