C16H17ClN2O3S2 — CID 9140977
3-(4-chlorophenyl)sulfanyl-N-(4-methyl-3-sulfamoylphenyl)propanamide (PubChem CID 9140977) has the molecular formula C16H17ClN2O3S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-(4-methyl-3-sulfamoylphenyl)propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-(4-methyl-3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 9140977 |
| Molecular Formula | C16H17ClN2O3S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-(4-methyl-3-sulfamoylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCSc2ccc(Cl)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H17ClN2O3S2/c1-11-2-5-13(10-15(11)24(18,21)22)19-16(20)8-9-23-14-6-3-12(17)4-7-14/h2-7,10H,8-9H2,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | OLQRAQKYZNWLKW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |