C10H14ClN3O5S2 — CID 71418116
N-(5-chloro-2,4-disulfamoylphenyl)-2-methylpropanamide (PubChem CID 71418116) has the molecular formula C10H14ClN3O5S2 and a molecular weight of 355.83 g/mol. Its IUPAC name is N-(5-chloro-2,4-disulfamoylphenyl)-2-methylpropanamide.
| Compound Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 71418116 |
| Molecular Formula | C10H14ClN3O5S2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cc(Cl)c(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H14ClN3O5S2/c1-5(2)10(15)14-7-3-6(11)8(20(12,16)17)4-9(7)21(13,18)19/h3-5H,1-2H3,(H,14,15)(H2,12,16,17)(H2,13,18,19) |
| InChIKey | AWAOBGIMFFLBAK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |