3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride

C10H10Cl3NO3S — CID 43109589

IUPAC3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride
SMILESCC(C)C(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl
InChIInChI=1S/C10H10Cl3NO3S/c1-5(2)10(15)14-9-7(11)3-6(4-8(9)12)18(13,16)17/h3-5H,1-2H3,(H,14,15)
InChIKeyQWNQRCABLSSDRO-UHFFFAOYSA-N
MW330.62 g/mol
LogP3.52
Rot. Bonds3

About 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride

3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride (PubChem CID 43109589) has the molecular formula C10H10Cl3NO3S and a molecular weight of 330.62 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride.

Molecular Properties

Compound Name3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride
PubChem CID43109589
Molecular FormulaC10H10Cl3NO3S
Molecular Weight330.62 g/mol
Exact Mass328.94
IUPAC Name3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride
SMILESCC(C)C(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl
InChIInChI=1S/C10H10Cl3NO3S/c1-5(2)10(15)14-9-7(11)3-6(4-8(9)12)18(13,16)17/h3-5H,1-2H3,(H,14,15)
InChIKeyQWNQRCABLSSDRO-UHFFFAOYSA-N
XLogP3.52
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.62
LogP ≤ 53.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride?
The IUPAC name of 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride (CID 43109589) is 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride.
What is the SMILES notation for 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride?
The canonical SMILES for 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride is CC(C)C(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl.
What is the InChIKey of 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride?
The InChIKey is QWNQRCABLSSDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl3NO3S/c1-5(2)10(15)14-9-7(11)3-6(4-8(9)12)18(13,16)17/h3-5H,1-2H3,(H,14,15).
What are the key properties of 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride?
3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride has a molecular weight of 330.62 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride is sourced from PubChem (CID 43109589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).