C10H10Cl3NO3S — CID 43109589
3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride (PubChem CID 43109589) has the molecular formula C10H10Cl3NO3S and a molecular weight of 330.62 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride.
| Compound Name | 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43109589 |
| Molecular Formula | C10H10Cl3NO3S |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | 3,5-dichloro-4-(2-methylpropanoylamino)benzenesulfonyl chloride |
| SMILES | CC(C)C(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl3NO3S/c1-5(2)10(15)14-9-7(11)3-6(4-8(9)12)18(13,16)17/h3-5H,1-2H3,(H,14,15) |
| InChIKey | QWNQRCABLSSDRO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |