C8H14N4O3S — CID 61131141
2-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)propanamide (PubChem CID 61131141) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)propanamide.
| Compound Name | 2-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 61131141 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)propanamide |
| SMILES | CC(C)C(=O)Nc1nn(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H14N4O3S/c1-5(2)8(13)10-7-6(16(9,14)15)4-12(3)11-7/h4-5H,1-3H3,(H2,9,14,15)(H,10,11,13) |
| InChIKey | PMDZUNNMKZXTCX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |