C7H14N4O4S2 — CID 61132283
1-methyl-3-(propan-2-ylsulfonylamino)pyrazole-4-sulfonamide (PubChem CID 61132283) has the molecular formula C7H14N4O4S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-methyl-3-(propan-2-ylsulfonylamino)pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-3-(propan-2-ylsulfonylamino)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61132283 |
| Molecular Formula | C7H14N4O4S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-methyl-3-(propan-2-ylsulfonylamino)pyrazole-4-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1nn(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H14N4O4S2/c1-5(2)17(14,15)10-7-6(16(8,12)13)4-11(3)9-7/h4-5H,1-3H3,(H,9,10)(H2,8,12,13) |
| InChIKey | LCGZFJLBEAKGTG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |