C11H12FN5O3S — CID 61132441
1-(4-fluorophenyl)-3-(1-methyl-4-sulfamoylpyrazol-3-yl)urea (PubChem CID 61132441) has the molecular formula C11H12FN5O3S and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(1-methyl-4-sulfamoylpyrazol-3-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(1-methyl-4-sulfamoylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 61132441 |
| Molecular Formula | C11H12FN5O3S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(1-methyl-4-sulfamoylpyrazol-3-yl)urea |
| SMILES | Cn1cc(S(N)(=O)=O)c(NC(=O)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C11H12FN5O3S/c1-17-6-9(21(13,19)20)10(16-17)15-11(18)14-8-4-2-7(12)3-5-8/h2-6H,1H3,(H2,13,19,20)(H2,14,15,16,18) |
| InChIKey | SJQQHIMYSUZTTR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |