C12H13FN4O — CID 2811435
1-(1,3-dimethylpyrazol-4-yl)-3-(4-fluorophenyl)urea (PubChem CID 2811435) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 2811435 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-(4-fluorophenyl)urea |
| SMILES | Cc1nn(C)cc1NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN4O/c1-8-11(7-17(2)16-8)15-12(18)14-10-5-3-9(13)4-6-10/h3-7H,1-2H3,(H2,14,15,18) |
| InChIKey | GZDYOTCSJIWHGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |