C12H10ClF3N4O — CID 2807795
1-(4-chlorophenyl)-3-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]urea (PubChem CID 2807795) has the molecular formula C12H10ClF3N4O and a molecular weight of 318.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 2807795 |
| Molecular Formula | C12H10ClF3N4O |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]urea |
| SMILES | Cn1cc(NC(=O)Nc2ccc(Cl)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H10ClF3N4O/c1-20-6-9(10(19-20)12(14,15)16)18-11(21)17-8-4-2-7(13)3-5-8/h2-6H,1H3,(H2,17,18,21) |
| InChIKey | XZIGZPRJTPDGCR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |