C13H13F3N4O3S — CID 87020352
N-[4-(methanesulfonamido)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87020352) has the molecular formula C13H13F3N4O3S and a molecular weight of 362.33 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-(methanesulfonamido)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87020352 |
| Molecular Formula | C13H13F3N4O3S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-[4-(methanesulfonamido)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(NS(C)(=O)=O)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F3N4O3S/c1-20-7-10(11(18-20)13(14,15)16)12(21)17-8-3-5-9(6-4-8)19-24(2,22)23/h3-7,19H,1-2H3,(H,17,21) |
| InChIKey | CLTXCFMNRBLZMT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |