C13H11ClF3N3O2 — CID 87008367
N-(3-chloro-4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87008367) has the molecular formula C13H11ClF3N3O2 and a molecular weight of 333.70 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87008367 |
| Molecular Formula | C13H11ClF3N3O2 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cn(C)nc2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H11ClF3N3O2/c1-20-6-8(11(19-20)13(15,16)17)12(21)18-7-3-4-10(22-2)9(14)5-7/h3-6H,1-2H3,(H,18,21) |
| InChIKey | UDUJDQQCJQGRHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |