C8H11ClN4O2 — CID 102806777
2-chloro-N-[(1,3-dimethylpyrazol-4-yl)carbamoyl]acetamide (PubChem CID 102806777) has the molecular formula C8H11ClN4O2 and a molecular weight of 230.66 g/mol. Its IUPAC name is 2-chloro-N-[(1,3-dimethylpyrazol-4-yl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(1,3-dimethylpyrazol-4-yl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 102806777 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-chloro-N-[(1,3-dimethylpyrazol-4-yl)carbamoyl]acetamide |
| SMILES | Cc1nn(C)cc1NC(=O)NC(=O)CCl |
| InChI | InChI=1S/C8H11ClN4O2/c1-5-6(4-13(2)12-5)10-8(15)11-7(14)3-9/h4H,3H2,1-2H3,(H2,10,11,14,15) |
| InChIKey | GIYJRGZRRSVGPT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|