C8H11ClN4O2 — CID 19410660
4-[(2-chloroacetyl)amino]-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 19410660) has the molecular formula C8H11ClN4O2 and a molecular weight of 230.66 g/mol. Its IUPAC name is 4-[(2-chloroacetyl)amino]-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | 4-[(2-chloroacetyl)amino]-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19410660 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-[(2-chloroacetyl)amino]-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1nn(C)cc1NC(=O)CCl |
| InChI | InChI=1S/C8H11ClN4O2/c1-10-8(15)7-5(4-13(2)12-7)11-6(14)3-9/h4H,3H2,1-2H3,(H,10,15)(H,11,14) |
| InChIKey | BAPNKCAEYDOTNP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|