C18H21N5O3 — CID 166421920
N,1-dimethyl-4-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]pyrazole-3-carboxamide (PubChem CID 166421920) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N,1-dimethyl-4-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]pyrazole-3-carboxamide.
| Compound Name | N,1-dimethyl-4-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166421920 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N,1-dimethyl-4-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]pyrazole-3-carboxamide |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)Nc2cn(C)nc2C(=O)NC)cc1 |
| InChI | InChI=1S/C18H21N5O3/c1-4-15(24)20-13-8-5-12(6-9-13)7-10-16(25)21-14-11-23(3)22-17(14)18(26)19-2/h4-6,8-9,11H,1,7,10H2,2-3H3,(H,19,26)(H,20,24)(H,21,25) |
| InChIKey | JKQXDHKSVXTPMG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|