C7H11N3OS — CID 102807672
N-(1,3-dimethylpyrazol-4-yl)-2-sulfanylacetamide (PubChem CID 102807672) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-2-sulfanylacetamide.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 102807672 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-2-sulfanylacetamide |
| SMILES | Cc1nn(C)cc1NC(=O)CS |
| InChI | InChI=1S/C7H11N3OS/c1-5-6(3-10(2)9-5)8-7(11)4-12/h3,12H,4H2,1-2H3,(H,8,11) |
| InChIKey | XBYXVFJQYZRDEK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|